C21H21ClN8O — CID 145371373
N-[(1E,3E)-4-amino-4-chloro-1-(methylideneamino)buta-1,3-dien-2-yl]-2-[4-[2-[(1-methylpyrazol-4-yl)amino]pyrimidin-5-yl]phenyl]acetamide (PubChem CID 145371373) has the molecular formula C21H21ClN8O and a molecular weight of 436.91 g/mol. Its IUPAC name is N-[(1E,3E)-4-amino-4-chloro-1-(methylideneamino)buta-1,3-dien-2-yl]-2-[4-[2-[(1-methylpyrazol-4-yl)amino]pyrimidin-5-yl]phenyl]acetamide.
| Compound Name | N-[(1E,3E)-4-amino-4-chloro-1-(methylideneamino)buta-1,3-dien-2-yl]-2-[4-[2-[(1-methylpyrazol-4-yl)amino]pyrimidin-5-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 145371373 |
| Molecular Formula | C21H21ClN8O |
| Molecular Weight | 436.91 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | N-[(1E,3E)-4-amino-4-chloro-1-(methylideneamino)buta-1,3-dien-2-yl]-2-[4-[2-[(1-methylpyrazol-4-yl)amino]pyrimidin-5-yl]phenyl]acetamide |
| SMILES | C=N/C=C(\C=C(/N)Cl)NC(=O)Cc1ccc(-c2cnc(Nc3cnn(C)c3)nc2)cc1 |
| InChI | InChI=1S/C21H21ClN8O/c1-24-11-17(8-19(22)23)28-20(31)7-14-3-5-15(6-4-14)16-9-25-21(26-10-16)29-18-12-27-30(2)13-18/h3-6,8-13H,1,7,23H2,2H3,(H,28,31)(H,25,26,29)/b17-11+,19-8- |
| InChIKey | AAMHOCHVQAGRCO-YJNDQPENSA-N |
| XLogP | 2.86 |
| TPSA | 123.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.91 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|