C22H20ClN7O — CID 166877311
N-(6-chloro-5-methyl-3-pyridinyl)-2-[4-[2-[(1-methylpyrazol-4-yl)amino]pyrimidin-5-yl]phenyl]acetamide (PubChem CID 166877311) has the molecular formula C22H20ClN7O and a molecular weight of 433.90 g/mol. Its IUPAC name is N-(6-chloro-5-methyl-3-pyridinyl)-2-[4-[2-[(1-methylpyrazol-4-yl)amino]pyrimidin-5-yl]phenyl]acetamide.
| Compound Name | N-(6-chloro-5-methyl-3-pyridinyl)-2-[4-[2-[(1-methylpyrazol-4-yl)amino]pyrimidin-5-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 166877311 |
| Molecular Formula | C22H20ClN7O |
| Molecular Weight | 433.90 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | N-(6-chloro-5-methyl-3-pyridinyl)-2-[4-[2-[(1-methylpyrazol-4-yl)amino]pyrimidin-5-yl]phenyl]acetamide |
| SMILES | Cc1cc(NC(=O)Cc2ccc(-c3cnc(Nc4cnn(C)c4)nc3)cc2)cnc1Cl |
| InChI | InChI=1S/C22H20ClN7O/c1-14-7-18(11-24-21(14)23)28-20(31)8-15-3-5-16(6-4-15)17-9-25-22(26-10-17)29-19-12-27-30(2)13-19/h3-7,9-13H,8H2,1-2H3,(H,28,31)(H,25,26,29) |
| InChIKey | CMGQCDVCIMURBL-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.90 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|