C46H53N10+ — CID 145240829
7-N-[8-[[4-(4,5-diamino-2-anilinophenyl)imino-6-methylcyclohexa-1,5-dien-1-yl]amino]octyl]-8-methyl-5-phenylphenazin-5-ium-2,3,7-triamine (PubChem CID 145240829) has the molecular formula C46H53N10+ and a molecular weight of 746.00 g/mol. Its IUPAC name is 7-N-[8-[[4-(4,5-diamino-2-anilinophenyl)imino-6-methylcyclohexa-1,5-dien-1-yl]amino]octyl]-8-methyl-5-phenylphenazin-5-ium-2,3,7-triamine.
| Compound Name | 7-N-[8-[[4-(4,5-diamino-2-anilinophenyl)imino-6-methylcyclohexa-1,5-dien-1-yl]amino]octyl]-8-methyl-5-phenylphenazin-5-ium-2,3,7-triamine |
|---|---|
| PubChem CID | 145240829 |
| Molecular Formula | C46H53N10+ |
| Molecular Weight | 746.00 g/mol |
| Exact Mass | 745.44 |
| IUPAC Name | 7-N-[8-[[4-(4,5-diamino-2-anilinophenyl)imino-6-methylcyclohexa-1,5-dien-1-yl]amino]octyl]-8-methyl-5-phenylphenazin-5-ium-2,3,7-triamine |
| SMILES | CC1=C/C(=N/c2cc(N)c(N)cc2Nc2ccccc2)CC=C1NCCCCCCCCNc1cc2c(cc1C)nc1cc(N)c(N)cc1[n+]2-c1ccccc1 |
| InChI | InChI=1S/C46H52N10/c1-30-23-33(54-42-26-36(48)35(47)25-41(42)53-32-15-9-7-10-16-32)19-20-39(30)51-21-13-5-3-4-6-14-22-52-40-29-46-43(24-31(40)2)55-44-27-37(49)38(50)28-45(44)56(46)34-17-11-8-12-18-34/h7-12,15-18,20,23-29,51H,3-6,13-14,19,21-22H2,1-2H3,(H9,47,48,49,50,52,53,55)/p+1/b54-33+ |
| InChIKey | PPBZJBQYHDSPEE-XMQVLGHISA-O |
| XLogP | 9.39 |
| TPSA | 169.30 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.00 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|