About 2-bromobenzenesulfonyl chloride;ethane
2-bromobenzenesulfonyl chloride;ethane (PubChem CID 145241155) has the molecular formula C8H10BrClO2S
and a molecular weight of 285.59 g/mol. Its IUPAC name is 2-bromobenzenesulfonyl chloride;ethane.
Molecular Properties
| Compound Name | 2-bromobenzenesulfonyl chloride;ethane |
| PubChem CID | 145241155 |
| Molecular Formula | C8H10BrClO2S |
| Molecular Weight | 285.59 g/mol |
| Exact Mass | 283.93 |
| IUPAC Name | 2-bromobenzenesulfonyl chloride;ethane |
| SMILES | CC.O=S(=O)(Cl)c1ccccc1Br |
| InChI | InChI=1S/C6H4BrClO2S.C2H6/c7-5-3-1-2-4-6(5)11(8,9)10;1-2/h1-4H;1-2H3 |
| InChIKey | LXNISYZOQCXJBC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.59 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-bromobenzenesulfonyl chloride;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromobenzenesulfonyl chloride;ethane?
The IUPAC name of 2-bromobenzenesulfonyl chloride;ethane (CID 145241155) is 2-bromobenzenesulfonyl chloride;ethane.
What is the SMILES notation for 2-bromobenzenesulfonyl chloride;ethane?
The canonical SMILES for 2-bromobenzenesulfonyl chloride;ethane is CC.O=S(=O)(Cl)c1ccccc1Br.
What is the InChIKey of 2-bromobenzenesulfonyl chloride;ethane?
The InChIKey is LXNISYZOQCXJBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BrClO2S.C2H6/c7-5-3-1-2-4-6(5)11(8,9)10;1-2/h1-4H;1-2H3.
What are the key properties of 2-bromobenzenesulfonyl chloride;ethane?
2-bromobenzenesulfonyl chloride;ethane has a molecular weight of 285.59 g/mol, XLogP of 3.40, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromobenzenesulfonyl chloride;ethane is sourced from PubChem (CID 145241155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).