C27H41N — CID 145243225
ethane;10-methyl-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,8(19),9,11,13,17-heptaene (PubChem CID 145243225) has the molecular formula C27H41N and a molecular weight of 379.63 g/mol. Its IUPAC name is ethane;10-methyl-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,8(19),9,11,13,17-heptaene.
| Compound Name | ethane;10-methyl-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,8(19),9,11,13,17-heptaene |
|---|---|
| PubChem CID | 145243225 |
| Molecular Formula | C27H41N |
| Molecular Weight | 379.63 g/mol |
| Exact Mass | 379.32 |
| IUPAC Name | ethane;10-methyl-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,8(19),9,11,13,17-heptaene |
| SMILES | CC.CC.CC.CC.Cc1cc2c3c(n4c5c(c(c1)c24)=CCCC=5)C=CCC3 |
| InChI | InChI=1S/C19H17N.4C2H6/c1-12-10-15-13-6-2-4-8-17(13)20-18-9-5-3-7-14(18)16(11-12)19(15)20;4*1-2/h4,7-11H,2-3,5-6H2,1H3;4*1-2H3 |
| InChIKey | GZKIUNLPYGEPSA-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 4.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.63 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |