About 8-iodo-6-methyl-1,2-dihydronaphthalene
8-iodo-6-methyl-1,2-dihydronaphthalene (PubChem CID 166866293) has the molecular formula C11H11I
and a molecular weight of 270.11 g/mol. Its IUPAC name is 8-iodo-6-methyl-1,2-dihydronaphthalene.
Molecular Properties
| Compound Name | 8-iodo-6-methyl-1,2-dihydronaphthalene |
| PubChem CID | 166866293 |
| Molecular Formula | C11H11I |
| Molecular Weight | 270.11 g/mol |
| Exact Mass | 269.99 |
| IUPAC Name | 8-iodo-6-methyl-1,2-dihydronaphthalene |
| SMILES | Cc1cc(I)c2c(c1)C=CCC2 |
| InChI | InChI=1S/C11H11I/c1-8-6-9-4-2-3-5-10(9)11(12)7-8/h2,4,6-7H,3,5H2,1H3 |
| InChIKey | KAHSPJFKHOJLSG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.11 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 8-iodo-6-methyl-1,2-dihydronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-iodo-6-methyl-1,2-dihydronaphthalene?
The IUPAC name of 8-iodo-6-methyl-1,2-dihydronaphthalene (CID 166866293) is 8-iodo-6-methyl-1,2-dihydronaphthalene.
What is the SMILES notation for 8-iodo-6-methyl-1,2-dihydronaphthalene?
The canonical SMILES for 8-iodo-6-methyl-1,2-dihydronaphthalene is Cc1cc(I)c2c(c1)C=CCC2.
What is the InChIKey of 8-iodo-6-methyl-1,2-dihydronaphthalene?
The InChIKey is KAHSPJFKHOJLSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11I/c1-8-6-9-4-2-3-5-10(9)11(12)7-8/h2,4,6-7H,3,5H2,1H3.
What are the key properties of 8-iodo-6-methyl-1,2-dihydronaphthalene?
8-iodo-6-methyl-1,2-dihydronaphthalene has a molecular weight of 270.11 g/mol, XLogP of 3.56, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 8-iodo-6-methyl-1,2-dihydronaphthalene is sourced from PubChem (CID 166866293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).