C11H11I — CID 166866293
8-iodo-6-methyl-1,2-dihydronaphthalene (PubChem CID 166866293) has the molecular formula C11H11I and a molecular weight of 270.11 g/mol. Its IUPAC name is 8-iodo-6-methyl-1,2-dihydronaphthalene.
| Compound Name | 8-iodo-6-methyl-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 166866293 |
| Molecular Formula | C11H11I |
| Molecular Weight | 270.11 g/mol |
| Exact Mass | 269.99 |
| IUPAC Name | 8-iodo-6-methyl-1,2-dihydronaphthalene |
| SMILES | Cc1cc(I)c2c(c1)C=CCC2 |
| InChI | InChI=1S/C11H11I/c1-8-6-9-4-2-3-5-10(9)11(12)7-8/h2,4,6-7H,3,5H2,1H3 |
| InChIKey | KAHSPJFKHOJLSG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.11 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|