About 1-(3-methylphenyl)-7,8-dihydroisoquinoline
1-(3-methylphenyl)-7,8-dihydroisoquinoline (PubChem CID 71147862) has the molecular formula C16H15N
and a molecular weight of 221.30 g/mol. Its IUPAC name is 1-(3-methylphenyl)-7,8-dihydroisoquinoline.
Molecular Properties
| Compound Name | 1-(3-methylphenyl)-7,8-dihydroisoquinoline |
| PubChem CID | 71147862 |
| Molecular Formula | C16H15N |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 1-(3-methylphenyl)-7,8-dihydroisoquinoline |
| SMILES | Cc1cccc(-c2nccc3c2CCC=C3)c1 |
| InChI | InChI=1S/C16H15N/c1-12-5-4-7-14(11-12)16-15-8-3-2-6-13(15)9-10-17-16/h2,4-7,9-11H,3,8H2,1H3 |
| InChIKey | PSGTTYJZZGKZNC-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(3-methylphenyl)-7,8-dihydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-methylphenyl)-7,8-dihydroisoquinoline?
The IUPAC name of 1-(3-methylphenyl)-7,8-dihydroisoquinoline (CID 71147862) is 1-(3-methylphenyl)-7,8-dihydroisoquinoline.
What is the SMILES notation for 1-(3-methylphenyl)-7,8-dihydroisoquinoline?
The canonical SMILES for 1-(3-methylphenyl)-7,8-dihydroisoquinoline is Cc1cccc(-c2nccc3c2CCC=C3)c1.
What is the InChIKey of 1-(3-methylphenyl)-7,8-dihydroisoquinoline?
The InChIKey is PSGTTYJZZGKZNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N/c1-12-5-4-7-14(11-12)16-15-8-3-2-6-13(15)9-10-17-16/h2,4-7,9-11H,3,8H2,1H3.
What are the key properties of 1-(3-methylphenyl)-7,8-dihydroisoquinoline?
1-(3-methylphenyl)-7,8-dihydroisoquinoline has a molecular weight of 221.30 g/mol, XLogP of 4.02, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-methylphenyl)-7,8-dihydroisoquinoline is sourced from PubChem (CID 71147862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).