About cyclohexane;5-methoxy-1H-indole;N-methylcyclopentanecarboxamide
cyclohexane;5-methoxy-1H-indole;N-methylcyclopentanecarboxamide (PubChem CID 145244108) has the molecular formula C22H34N2O2
and a molecular weight of 358.53 g/mol. Its IUPAC name is cyclohexane;5-methoxy-1H-indole;N-methylcyclopentanecarboxamide.
Molecular Properties
| Compound Name | cyclohexane;5-methoxy-1H-indole;N-methylcyclopentanecarboxamide |
| PubChem CID | 145244108 |
| Molecular Formula | C22H34N2O2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.26 |
| IUPAC Name | cyclohexane;5-methoxy-1H-indole;N-methylcyclopentanecarboxamide |
| SMILES | C1CCCCC1.CNC(=O)C1CCCC1.COc1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C9H9NO.C7H13NO.C6H12/c1-11-8-2-3-9-7(6-8)4-5-10-9;1-8-7(9)6-4-2-3-5-6;1-2-4-6-5-3-1/h2-6,10H,1H3;6H,2-5H2,1H3,(H,8,9);1-6H2 |
| InChIKey | XRVSPDCNTODNSY-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclohexane;5-methoxy-1H-indole;N-methylcyclopentanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexane;5-methoxy-1H-indole;N-methylcyclopentanecarboxamide?
The IUPAC name of cyclohexane;5-methoxy-1H-indole;N-methylcyclopentanecarboxamide (CID 145244108) is cyclohexane;5-methoxy-1H-indole;N-methylcyclopentanecarboxamide.
What is the SMILES notation for cyclohexane;5-methoxy-1H-indole;N-methylcyclopentanecarboxamide?
The canonical SMILES for cyclohexane;5-methoxy-1H-indole;N-methylcyclopentanecarboxamide is C1CCCCC1.CNC(=O)C1CCCC1.COc1ccc2[nH]ccc2c1.
What is the InChIKey of cyclohexane;5-methoxy-1H-indole;N-methylcyclopentanecarboxamide?
The InChIKey is XRVSPDCNTODNSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO.C7H13NO.C6H12/c1-11-8-2-3-9-7(6-8)4-5-10-9;1-8-7(9)6-4-2-3-5-6;1-2-4-6-5-3-1/h2-6,10H,1H3;6H,2-5H2,1H3,(H,8,9);1-6H2.
What are the key properties of cyclohexane;5-methoxy-1H-indole;N-methylcyclopentanecarboxamide?
cyclohexane;5-methoxy-1H-indole;N-methylcyclopentanecarboxamide has a molecular weight of 358.53 g/mol, XLogP of 5.44, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexane;5-methoxy-1H-indole;N-methylcyclopentanecarboxamide is sourced from PubChem (CID 145244108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).