C17H21N3O3 — CID 51078250
1-(6-methoxy-1H-indole-2-carbonyl)-N-methylpiperidine-2-carboxamide (PubChem CID 51078250) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is 1-(6-methoxy-1H-indole-2-carbonyl)-N-methylpiperidine-2-carboxamide.
| Compound Name | 1-(6-methoxy-1H-indole-2-carbonyl)-N-methylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 51078250 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 1-(6-methoxy-1H-indole-2-carbonyl)-N-methylpiperidine-2-carboxamide |
| SMILES | CNC(=O)C1CCCCN1C(=O)c1cc2ccc(OC)cc2[nH]1 |
| InChI | InChI=1S/C17H21N3O3/c1-18-16(21)15-5-3-4-8-20(15)17(22)14-9-11-6-7-12(23-2)10-13(11)19-14/h6-7,9-10,15,19H,3-5,8H2,1-2H3,(H,18,21) |
| InChIKey | XXVBIKGWJWCSJV-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |