About 2-(7-bromo-6-fluoro-3-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-1-yl)phenol;ethane
2-(7-bromo-6-fluoro-3-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-1-yl)phenol;ethane (PubChem CID 145244192) has the molecular formula C19H20BrFN2O
and a molecular weight of 391.28 g/mol. Its IUPAC name is 2-(7-bromo-6-fluoro-3-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-1-yl)phenol;ethane.
Molecular Properties
| Compound Name | 2-(7-bromo-6-fluoro-3-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-1-yl)phenol;ethane |
| PubChem CID | 145244192 |
| Molecular Formula | C19H20BrFN2O |
| Molecular Weight | 391.28 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 2-(7-bromo-6-fluoro-3-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-1-yl)phenol;ethane |
| SMILES | CC.CC1CC(c2ccccc2O)n2c1nc1cc(F)c(Br)cc12 |
| InChI | InChI=1S/C17H14BrFN2O.C2H6/c1-9-6-14(10-4-2-3-5-16(10)22)21-15-7-11(18)12(19)8-13(15)20-17(9)21;1-2/h2-5,7-9,14,22H,6H2,1H3;1-2H3 |
| InChIKey | VNHFOLKUCAKSAD-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.28 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2-(7-bromo-6-fluoro-3-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-1-yl)phenol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7-bromo-6-fluoro-3-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-1-yl)phenol;ethane?
The IUPAC name of 2-(7-bromo-6-fluoro-3-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-1-yl)phenol;ethane (CID 145244192) is 2-(7-bromo-6-fluoro-3-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-1-yl)phenol;ethane.
What is the SMILES notation for 2-(7-bromo-6-fluoro-3-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-1-yl)phenol;ethane?
The canonical SMILES for 2-(7-bromo-6-fluoro-3-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-1-yl)phenol;ethane is CC.CC1CC(c2ccccc2O)n2c1nc1cc(F)c(Br)cc12.
What is the InChIKey of 2-(7-bromo-6-fluoro-3-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-1-yl)phenol;ethane?
The InChIKey is VNHFOLKUCAKSAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14BrFN2O.C2H6/c1-9-6-14(10-4-2-3-5-16(10)22)21-15-7-11(18)12(19)8-13(15)20-17(9)21;1-2/h2-5,7-9,14,22H,6H2,1H3;1-2H3.
What are the key properties of 2-(7-bromo-6-fluoro-3-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-1-yl)phenol;ethane?
2-(7-bromo-6-fluoro-3-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-1-yl)phenol;ethane has a molecular weight of 391.28 g/mol, XLogP of 5.77, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-bromo-6-fluoro-3-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-1-yl)phenol;ethane is sourced from PubChem (CID 145244192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).