C19H20BrFN2O — CID 145244192
2-(7-bromo-6-fluoro-3-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-1-yl)phenol;ethane (PubChem CID 145244192) has the molecular formula C19H20BrFN2O and a molecular weight of 391.28 g/mol. Its IUPAC name is 2-(7-bromo-6-fluoro-3-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-1-yl)phenol;ethane.
| Compound Name | 2-(7-bromo-6-fluoro-3-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-1-yl)phenol;ethane |
|---|---|
| PubChem CID | 145244192 |
| Molecular Formula | C19H20BrFN2O |
| Molecular Weight | 391.28 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 2-(7-bromo-6-fluoro-3-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-1-yl)phenol;ethane |
| SMILES | CC.CC1CC(c2ccccc2O)n2c1nc1cc(F)c(Br)cc12 |
| InChI | InChI=1S/C17H14BrFN2O.C2H6/c1-9-6-14(10-4-2-3-5-16(10)22)21-15-7-11(18)12(19)8-13(15)20-17(9)21;1-2/h2-5,7-9,14,22H,6H2,1H3;1-2H3 |
| InChIKey | VNHFOLKUCAKSAD-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.28 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|