C25H20N4S — CID 145252058
2-[5-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1H-indazol-3-yl]-4-thiophen-2-yl-1H-pyrrolo[3,2-c]pyridine (PubChem CID 145252058) has the molecular formula C25H20N4S and a molecular weight of 408.53 g/mol. Its IUPAC name is 2-[5-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1H-indazol-3-yl]-4-thiophen-2-yl-1H-pyrrolo[3,2-c]pyridine.
| Compound Name | 2-[5-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1H-indazol-3-yl]-4-thiophen-2-yl-1H-pyrrolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 145252058 |
| Molecular Formula | C25H20N4S |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 2-[5-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1H-indazol-3-yl]-4-thiophen-2-yl-1H-pyrrolo[3,2-c]pyridine |
| SMILES | C=C/C=C\C(=C/C)c1ccc2[nH]nc(-c3cc4c(-c5cccs5)nccc4[nH]3)c2c1 |
| InChI | InChI=1S/C25H20N4S/c1-3-5-7-16(4-2)17-9-10-21-18(14-17)24(29-28-21)22-15-19-20(27-22)11-12-26-25(19)23-8-6-13-30-23/h3-15,27H,1H2,2H3,(H,28,29)/b7-5-,16-4+ |
| InChIKey | CUZXHWNJGUICHX-MOLMNCEOSA-N |
| XLogP | 6.98 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|