C25H21N7 — CID 145253765
3-[(1Z)-1-pyridin-3-ylpenta-1,3-dienyl]-5-(5-pyrimidin-5-yl-1H-indazol-3-yl)-1H-pyrrol-2-amine (PubChem CID 145253765) has the molecular formula C25H21N7 and a molecular weight of 419.49 g/mol. Its IUPAC name is 3-[(1Z)-1-pyridin-3-ylpenta-1,3-dienyl]-5-(5-pyrimidin-5-yl-1H-indazol-3-yl)-1H-pyrrol-2-amine.
| Compound Name | 3-[(1Z)-1-pyridin-3-ylpenta-1,3-dienyl]-5-(5-pyrimidin-5-yl-1H-indazol-3-yl)-1H-pyrrol-2-amine |
|---|---|
| PubChem CID | 145253765 |
| Molecular Formula | C25H21N7 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | 3-[(1Z)-1-pyridin-3-ylpenta-1,3-dienyl]-5-(5-pyrimidin-5-yl-1H-indazol-3-yl)-1H-pyrrol-2-amine |
| SMILES | CC=C/C=C(/c1cccnc1)c1cc(-c2n[nH]c3ccc(-c4cncnc4)cc23)[nH]c1N |
| InChI | InChI=1S/C25H21N7/c1-2-3-6-19(17-5-4-9-27-12-17)20-11-23(30-25(20)26)24-21-10-16(7-8-22(21)31-32-24)18-13-28-15-29-14-18/h2-15,30H,26H2,1H3,(H,31,32)/b3-2?,19-6- |
| InChIKey | NYVVZBAHZPTYAQ-WPKGWARDSA-N |
| XLogP | 5.00 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|