C27H19FN4 — CID 145253838
3-[4-[(Z)-1-(3-fluorophenyl)but-1-en-3-ynyl]-5-methyl-1H-pyrrol-2-yl]-5-pyridin-4-yl-1H-indazole (PubChem CID 145253838) has the molecular formula C27H19FN4 and a molecular weight of 418.48 g/mol. Its IUPAC name is 3-[4-[(Z)-1-(3-fluorophenyl)but-1-en-3-ynyl]-5-methyl-1H-pyrrol-2-yl]-5-pyridin-4-yl-1H-indazole.
| Compound Name | 3-[4-[(Z)-1-(3-fluorophenyl)but-1-en-3-ynyl]-5-methyl-1H-pyrrol-2-yl]-5-pyridin-4-yl-1H-indazole |
|---|---|
| PubChem CID | 145253838 |
| Molecular Formula | C27H19FN4 |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 3-[4-[(Z)-1-(3-fluorophenyl)but-1-en-3-ynyl]-5-methyl-1H-pyrrol-2-yl]-5-pyridin-4-yl-1H-indazole |
| SMILES | C#C/C=C(/c1cccc(F)c1)c1cc(-c2n[nH]c3ccc(-c4ccncc4)cc23)[nH]c1C |
| InChI | InChI=1S/C27H19FN4/c1-3-5-22(20-6-4-7-21(28)14-20)23-16-26(30-17(23)2)27-24-15-19(8-9-25(24)31-32-27)18-10-12-29-13-11-18/h1,4-16,30H,2H3,(H,31,32)/b22-5- |
| InChIKey | KRFRMTLFAOMFGM-IOMHPIHLSA-N |
| XLogP | 6.13 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|