C14H22O2 — CID 14525451
(1S,2S,3R,8R)-3-ethoxy-2,7-dimethyl-11-oxatricyclo[6.2.1.02,6]undec-6-ene (PubChem CID 14525451) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is (1S,2S,3R,8R)-3-ethoxy-2,7-dimethyl-11-oxatricyclo[6.2.1.02,6]undec-6-ene.
| Compound Name | (1S,2S,3R,8R)-3-ethoxy-2,7-dimethyl-11-oxatricyclo[6.2.1.02,6]undec-6-ene |
|---|---|
| PubChem CID | 14525451 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | (1S,2S,3R,8R)-3-ethoxy-2,7-dimethyl-11-oxatricyclo[6.2.1.02,6]undec-6-ene |
| SMILES | CCO[C@@H]1CCC2=C(C)[C@H]3CC[C@H](O3)[C@@]21C |
| InChI | InChI=1S/C14H22O2/c1-4-15-12-7-5-10-9(2)11-6-8-13(16-11)14(10,12)3/h11-13H,4-8H2,1-3H3/t11-,12-,13+,14+/m1/s1 |
| InChIKey | KKLHDFCVDJQWKD-MQYQWHSLSA-N |
| XLogP | 3.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|