C11H18O3 — CID 23039781
2,3-bis(methoxymethyl)-1-methyl-7-oxabicyclo[2.2.1]hept-2-ene (PubChem CID 23039781) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is 2,3-bis(methoxymethyl)-1-methyl-7-oxabicyclo[2.2.1]hept-2-ene.
| Compound Name | 2,3-bis(methoxymethyl)-1-methyl-7-oxabicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 23039781 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | 2,3-bis(methoxymethyl)-1-methyl-7-oxabicyclo[2.2.1]hept-2-ene |
| SMILES | COCC1=C(COC)C2(C)CCC1O2 |
| InChI | InChI=1S/C11H18O3/c1-11-5-4-10(14-11)8(6-12-2)9(11)7-13-3/h10H,4-7H2,1-3H3 |
| InChIKey | RVAJUGFSXXTISE-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|