C14H24N2O — CID 145255052
N-[(3E)-2,4-dimethylhexa-1,3,5-trien-3-yl]formamide;2-methylpyrrolidine (PubChem CID 145255052) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is N-[(3E)-2,4-dimethylhexa-1,3,5-trien-3-yl]formamide;2-methylpyrrolidine.
| Compound Name | N-[(3E)-2,4-dimethylhexa-1,3,5-trien-3-yl]formamide;2-methylpyrrolidine |
|---|---|
| PubChem CID | 145255052 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | N-[(3E)-2,4-dimethylhexa-1,3,5-trien-3-yl]formamide;2-methylpyrrolidine |
| SMILES | C=C/C(C)=C(/NC=O)C(=C)C.CC1CCCN1 |
| InChI | InChI=1S/C9H13NO.C5H11N/c1-5-8(4)9(7(2)3)10-6-11;1-5-3-2-4-6-5/h5-6H,1-2H2,3-4H3,(H,10,11);5-6H,2-4H2,1H3/b9-8+; |
| InChIKey | VKQRDNNYFMAMJZ-HRNDJLQDSA-N |
| XLogP | 2.53 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|