C12H19NO — CID 145255312
ethane;1-(1,3,4,5-tetrahydroisoindol-2-yl)ethanone (PubChem CID 145255312) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is ethane;1-(1,3,4,5-tetrahydroisoindol-2-yl)ethanone.
| Compound Name | ethane;1-(1,3,4,5-tetrahydroisoindol-2-yl)ethanone |
|---|---|
| PubChem CID | 145255312 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | ethane;1-(1,3,4,5-tetrahydroisoindol-2-yl)ethanone |
| SMILES | CC.CC(=O)N1CC2=C(CCC=C2)C1 |
| InChI | InChI=1S/C10H13NO.C2H6/c1-8(12)11-6-9-4-2-3-5-10(9)7-11;1-2/h2,4H,3,5-7H2,1H3;1-2H3 |
| InChIKey | QGXHIRDSCWGGSQ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |