C20H21BrF2N3O3S+ — CID 145256956
[1-amino-2-[1-(2-fluoro-4-methylsulfonylphenyl)piperidin-4-yl]-2-oxoethylidene]-(3-bromo-4-fluorophenyl)azanium (PubChem CID 145256956) has the molecular formula C20H21BrF2N3O3S+ and a molecular weight of 501.37 g/mol. Its IUPAC name is [1-amino-2-[1-(2-fluoro-4-methylsulfonylphenyl)piperidin-4-yl]-2-oxoethylidene]-(3-bromo-4-fluorophenyl)azanium.
| Compound Name | [1-amino-2-[1-(2-fluoro-4-methylsulfonylphenyl)piperidin-4-yl]-2-oxoethylidene]-(3-bromo-4-fluorophenyl)azanium |
|---|---|
| PubChem CID | 145256956 |
| Molecular Formula | C20H21BrF2N3O3S+ |
| Molecular Weight | 501.37 g/mol |
| Exact Mass | 500.04 |
| IUPAC Name | [1-amino-2-[1-(2-fluoro-4-methylsulfonylphenyl)piperidin-4-yl]-2-oxoethylidene]-(3-bromo-4-fluorophenyl)azanium |
| SMILES | CS(=O)(=O)c1ccc(N2CCC(C(=O)/C(N)=[NH+]/c3ccc(F)c(Br)c3)CC2)c(F)c1 |
| InChI | InChI=1S/C20H20BrF2N3O3S/c1-30(28,29)14-3-5-18(17(23)11-14)26-8-6-12(7-9-26)19(27)20(24)25-13-2-4-16(22)15(21)10-13/h2-5,10-12H,6-9H2,1H3,(H2,24,25)/p+1 |
| InChIKey | GUOKWVQEAHYSTO-UHFFFAOYSA-O |
| XLogP | 1.69 |
| TPSA | 94.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.37 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|