C23H33FN4O4S — CID 58333439
[4-[[1-(2-fluoro-4-methylsulfonylphenyl)piperidin-4-ylidene]amino]oxypiperidin-1-yl]-piperidin-1-ylmethanone (PubChem CID 58333439) has the molecular formula C23H33FN4O4S and a molecular weight of 480.61 g/mol. Its IUPAC name is [4-[[1-(2-fluoro-4-methylsulfonylphenyl)piperidin-4-ylidene]amino]oxypiperidin-1-yl]-piperidin-1-ylmethanone.
| Compound Name | [4-[[1-(2-fluoro-4-methylsulfonylphenyl)piperidin-4-ylidene]amino]oxypiperidin-1-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 58333439 |
| Molecular Formula | C23H33FN4O4S |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | [4-[[1-(2-fluoro-4-methylsulfonylphenyl)piperidin-4-ylidene]amino]oxypiperidin-1-yl]-piperidin-1-ylmethanone |
| SMILES | CS(=O)(=O)c1ccc(N2CCC(=NOC3CCN(C(=O)N4CCCCC4)CC3)CC2)c(F)c1 |
| InChI | InChI=1S/C23H33FN4O4S/c1-33(30,31)20-5-6-22(21(24)17-20)26-13-7-18(8-14-26)25-32-19-9-15-28(16-10-19)23(29)27-11-3-2-4-12-27/h5-6,17,19H,2-4,7-16H2,1H3 |
| InChIKey | CYBFMGBZODZGEW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 82.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|