C21H32F2N4O5S — CID 159205040
molecular hydrogen;propan-2-yl 4-[[1-[2,5-difluoro-4-(methanesulfonamido)phenyl]piperidin-4-ylidene]amino]oxypiperidine-1-carboxylate (PubChem CID 159205040) has the molecular formula C21H32F2N4O5S and a molecular weight of 490.57 g/mol. Its IUPAC name is molecular hydrogen;propan-2-yl 4-[[1-[2,5-difluoro-4-(methanesulfonamido)phenyl]piperidin-4-ylidene]amino]oxypiperidine-1-carboxylate.
| Compound Name | molecular hydrogen;propan-2-yl 4-[[1-[2,5-difluoro-4-(methanesulfonamido)phenyl]piperidin-4-ylidene]amino]oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 159205040 |
| Molecular Formula | C21H32F2N4O5S |
| Molecular Weight | 490.57 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | molecular hydrogen;propan-2-yl 4-[[1-[2,5-difluoro-4-(methanesulfonamido)phenyl]piperidin-4-ylidene]amino]oxypiperidine-1-carboxylate |
| SMILES | CC(C)OC(=O)N1CCC(ON=C2CCN(c3cc(F)c(NS(C)(=O)=O)cc3F)CC2)CC1.[H][H] |
| InChI | InChI=1S/C21H30F2N4O5S.H2/c1-14(2)31-21(28)27-10-6-16(7-11-27)32-24-15-4-8-26(9-5-15)20-13-17(22)19(12-18(20)23)25-33(3,29)30;/h12-14,16,25H,4-11H2,1-3H3;1H |
| InChIKey | KPTSMWNRNNMAJL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.57 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|