C22H26BrF2N5O — CID 86655029
1-(4-bromo-2,5-difluorophenyl)-N-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]oxypiperidin-4-imine (PubChem CID 86655029) has the molecular formula C22H26BrF2N5O and a molecular weight of 494.38 g/mol. Its IUPAC name is 1-(4-bromo-2,5-difluorophenyl)-N-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]oxypiperidin-4-imine.
| Compound Name | 1-(4-bromo-2,5-difluorophenyl)-N-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]oxypiperidin-4-imine |
|---|---|
| PubChem CID | 86655029 |
| Molecular Formula | C22H26BrF2N5O |
| Molecular Weight | 494.38 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | 1-(4-bromo-2,5-difluorophenyl)-N-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]oxypiperidin-4-imine |
| SMILES | CCc1cnc(N2CCC(ON=C3CCN(c4cc(F)c(Br)cc4F)CC3)CC2)nc1 |
| InChI | InChI=1S/C22H26BrF2N5O/c1-2-15-13-26-22(27-14-15)30-9-5-17(6-10-30)31-28-16-3-7-29(8-4-16)21-12-19(24)18(23)11-20(21)25/h11-14,17H,2-10H2,1H3 |
| InChIKey | RSEHCGDKPQIFIT-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 53.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.38 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|