C22H32F2N4O3 — CID 76764749
propan-2-yl 4-[[1-[4-(1-aminoethyl)-2,5-difluorophenyl]piperidin-4-ylidene]amino]oxypiperidine-1-carboxylate (PubChem CID 76764749) has the molecular formula C22H32F2N4O3 and a molecular weight of 438.52 g/mol. Its IUPAC name is propan-2-yl 4-[[1-[4-(1-aminoethyl)-2,5-difluorophenyl]piperidin-4-ylidene]amino]oxypiperidine-1-carboxylate.
| Compound Name | propan-2-yl 4-[[1-[4-(1-aminoethyl)-2,5-difluorophenyl]piperidin-4-ylidene]amino]oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 76764749 |
| Molecular Formula | C22H32F2N4O3 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | propan-2-yl 4-[[1-[4-(1-aminoethyl)-2,5-difluorophenyl]piperidin-4-ylidene]amino]oxypiperidine-1-carboxylate |
| SMILES | CC(C)OC(=O)N1CCC(ON=C2CCN(c3cc(F)c(C(C)N)cc3F)CC2)CC1 |
| InChI | InChI=1S/C22H32F2N4O3/c1-14(2)30-22(29)28-10-6-17(7-11-28)31-26-16-4-8-27(9-5-16)21-13-19(23)18(15(3)25)12-20(21)24/h12-15,17H,4-11,25H2,1-3H3 |
| InChIKey | HSVZJPQQAQJKGK-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|