C20H27Cl2N5O5 — CID 86655013
methyl 3,6-dichloro-5-[4-(1-propan-2-yloxycarbonylpiperidin-4-yl)oxyiminopiperidin-1-yl]pyrazine-2-carboxylate (PubChem CID 86655013) has the molecular formula C20H27Cl2N5O5 and a molecular weight of 488.37 g/mol. Its IUPAC name is methyl 3,6-dichloro-5-[4-(1-propan-2-yloxycarbonylpiperidin-4-yl)oxyiminopiperidin-1-yl]pyrazine-2-carboxylate.
| Compound Name | methyl 3,6-dichloro-5-[4-(1-propan-2-yloxycarbonylpiperidin-4-yl)oxyiminopiperidin-1-yl]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 86655013 |
| Molecular Formula | C20H27Cl2N5O5 |
| Molecular Weight | 488.37 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | methyl 3,6-dichloro-5-[4-(1-propan-2-yloxycarbonylpiperidin-4-yl)oxyiminopiperidin-1-yl]pyrazine-2-carboxylate |
| SMILES | COC(=O)c1nc(Cl)c(N2CCC(=NOC3CCN(C(=O)OC(C)C)CC3)CC2)nc1Cl |
| InChI | InChI=1S/C20H27Cl2N5O5/c1-12(2)31-20(29)27-10-6-14(7-11-27)32-25-13-4-8-26(9-5-13)18-17(22)23-15(16(21)24-18)19(28)30-3/h12,14H,4-11H2,1-3H3 |
| InChIKey | VNUUIINRKBYDJO-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 106.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.37 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|