C15H24ClN3O4 — CID 154553002
propan-2-yl 4-[(6-chloro-5-methoxy-1-methyl-2H-pyrimidin-4-yl)oxy]piperidine-1-carboxylate (PubChem CID 154553002) has the molecular formula C15H24ClN3O4 and a molecular weight of 345.83 g/mol. Its IUPAC name is propan-2-yl 4-[(6-chloro-5-methoxy-1-methyl-2H-pyrimidin-4-yl)oxy]piperidine-1-carboxylate.
| Compound Name | propan-2-yl 4-[(6-chloro-5-methoxy-1-methyl-2H-pyrimidin-4-yl)oxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 154553002 |
| Molecular Formula | C15H24ClN3O4 |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | propan-2-yl 4-[(6-chloro-5-methoxy-1-methyl-2H-pyrimidin-4-yl)oxy]piperidine-1-carboxylate |
| SMILES | COC1=C(Cl)N(C)CN=C1OC1CCN(C(=O)OC(C)C)CC1 |
| InChI | InChI=1S/C15H24ClN3O4/c1-10(2)22-15(20)19-7-5-11(6-8-19)23-14-12(21-4)13(16)18(3)9-17-14/h10-11H,5-9H2,1-4H3 |
| InChIKey | FUVBMHPNLUMZMT-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 63.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|