C19H30N4O4 — CID 58484438
propan-2-yl 4-(5-methyl-6-piperidin-4-yloxypyrimidin-4-yl)oxypiperidine-1-carboxylate (PubChem CID 58484438) has the molecular formula C19H30N4O4 and a molecular weight of 378.47 g/mol. Its IUPAC name is propan-2-yl 4-(5-methyl-6-piperidin-4-yloxypyrimidin-4-yl)oxypiperidine-1-carboxylate.
| Compound Name | propan-2-yl 4-(5-methyl-6-piperidin-4-yloxypyrimidin-4-yl)oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 58484438 |
| Molecular Formula | C19H30N4O4 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | propan-2-yl 4-(5-methyl-6-piperidin-4-yloxypyrimidin-4-yl)oxypiperidine-1-carboxylate |
| SMILES | Cc1c(OC2CCNCC2)ncnc1OC1CCN(C(=O)OC(C)C)CC1 |
| InChI | InChI=1S/C19H30N4O4/c1-13(2)25-19(24)23-10-6-16(7-11-23)27-18-14(3)17(21-12-22-18)26-15-4-8-20-9-5-15/h12-13,15-16,20H,4-11H2,1-3H3 |
| InChIKey | KEAZVWXBJMPMQI-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |