C19H23FN4O5 — CID 59856747
propan-2-yl 4-[6-(3-fluoro-1-oxidopyridin-1-ium-4-yl)oxy-5-methylpyrimidin-4-yl]oxypiperidine-1-carboxylate (PubChem CID 59856747) has the molecular formula C19H23FN4O5 and a molecular weight of 406.41 g/mol. Its IUPAC name is propan-2-yl 4-[6-(3-fluoro-1-oxidopyridin-1-ium-4-yl)oxy-5-methylpyrimidin-4-yl]oxypiperidine-1-carboxylate.
| Compound Name | propan-2-yl 4-[6-(3-fluoro-1-oxidopyridin-1-ium-4-yl)oxy-5-methylpyrimidin-4-yl]oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 59856747 |
| Molecular Formula | C19H23FN4O5 |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | propan-2-yl 4-[6-(3-fluoro-1-oxidopyridin-1-ium-4-yl)oxy-5-methylpyrimidin-4-yl]oxypiperidine-1-carboxylate |
| SMILES | Cc1c(Oc2cc[n+]([O-])cc2F)ncnc1OC1CCN(C(=O)OC(C)C)CC1 |
| InChI | InChI=1S/C19H23FN4O5/c1-12(2)27-19(25)23-7-4-14(5-8-23)28-17-13(3)18(22-11-21-17)29-16-6-9-24(26)10-15(16)20/h6,9-12,14H,4-5,7-8H2,1-3H3 |
| InChIKey | VNNFTCVVXNAIME-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 100.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|