C24H31F2N3O5 — CID 58333589
propan-2-yl 4-[[1-[2,5-difluoro-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl]piperidin-4-ylidene]amino]oxypiperidine-1-carboxylate (PubChem CID 58333589) has the molecular formula C24H31F2N3O5 and a molecular weight of 479.52 g/mol. Its IUPAC name is propan-2-yl 4-[[1-[2,5-difluoro-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl]piperidin-4-ylidene]amino]oxypiperidine-1-carboxylate.
| Compound Name | propan-2-yl 4-[[1-[2,5-difluoro-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl]piperidin-4-ylidene]amino]oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 58333589 |
| Molecular Formula | C24H31F2N3O5 |
| Molecular Weight | 479.52 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | propan-2-yl 4-[[1-[2,5-difluoro-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl]piperidin-4-ylidene]amino]oxypiperidine-1-carboxylate |
| SMILES | COC(=O)/C=C/c1cc(F)c(N2CCC(=NOC3CCN(C(=O)OC(C)C)CC3)CC2)cc1F |
| InChI | InChI=1S/C24H31F2N3O5/c1-16(2)33-24(31)29-12-8-19(9-13-29)34-27-18-6-10-28(11-7-18)22-15-20(25)17(14-21(22)26)4-5-23(30)32-3/h4-5,14-16,19H,6-13H2,1-3H3/b5-4+ |
| InChIKey | QHYXSXMFPKVASB-SNAWJCMRSA-N |
| XLogP | 4.13 |
| TPSA | 80.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.52 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|