C18H23F2N3O3 — CID 141306037
2-[2,5-difluoro-4-(4-piperidin-4-yloxyiminopiperidin-1-yl)phenyl]acetic acid (PubChem CID 141306037) has the molecular formula C18H23F2N3O3 and a molecular weight of 367.40 g/mol. Its IUPAC name is 2-[2,5-difluoro-4-(4-piperidin-4-yloxyiminopiperidin-1-yl)phenyl]acetic acid.
| Compound Name | 2-[2,5-difluoro-4-(4-piperidin-4-yloxyiminopiperidin-1-yl)phenyl]acetic acid |
|---|---|
| PubChem CID | 141306037 |
| Molecular Formula | C18H23F2N3O3 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 2-[2,5-difluoro-4-(4-piperidin-4-yloxyiminopiperidin-1-yl)phenyl]acetic acid |
| SMILES | O=C(O)Cc1cc(F)c(N2CCC(=NOC3CCNCC3)CC2)cc1F |
| InChI | InChI=1S/C18H23F2N3O3/c19-15-11-17(16(20)9-12(15)10-18(24)25)23-7-3-13(4-8-23)22-26-14-1-5-21-6-2-14/h9,11,14,21H,1-8,10H2,(H,24,25) |
| InChIKey | FUGSFKZEISQRKI-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|