C24H29F2N5O2 — CID 88921019
4-[4-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]oxyiminocyclohexyl]-2,3-difluorobenzamide (PubChem CID 88921019) has the molecular formula C24H29F2N5O2 and a molecular weight of 457.53 g/mol. Its IUPAC name is 4-[4-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]oxyiminocyclohexyl]-2,3-difluorobenzamide.
| Compound Name | 4-[4-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]oxyiminocyclohexyl]-2,3-difluorobenzamide |
|---|---|
| PubChem CID | 88921019 |
| Molecular Formula | C24H29F2N5O2 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | 4-[4-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]oxyiminocyclohexyl]-2,3-difluorobenzamide |
| SMILES | CCc1cnc(N2CCC(ON=C3CCC(c4ccc(C(N)=O)c(F)c4F)CC3)CC2)nc1 |
| InChI | InChI=1S/C24H29F2N5O2/c1-2-15-13-28-24(29-14-15)31-11-9-18(10-12-31)33-30-17-5-3-16(4-6-17)19-7-8-20(23(27)32)22(26)21(19)25/h7-8,13-14,16,18H,2-6,9-12H2,1H3,(H2,27,32)/b30-17- |
| InChIKey | FYSKSUBSPUCJTJ-LQNQUEJISA-N |
| XLogP | 4.12 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|