C23H27F2N5O2 — CID 88921057
2,5-difluoro-4-[4-[1-(5-methylpyrimidin-2-yl)piperidin-4-yl]oxyiminocyclohexyl]benzamide (PubChem CID 88921057) has the molecular formula C23H27F2N5O2 and a molecular weight of 443.50 g/mol. Its IUPAC name is 2,5-difluoro-4-[4-[1-(5-methylpyrimidin-2-yl)piperidin-4-yl]oxyiminocyclohexyl]benzamide.
| Compound Name | 2,5-difluoro-4-[4-[1-(5-methylpyrimidin-2-yl)piperidin-4-yl]oxyiminocyclohexyl]benzamide |
|---|---|
| PubChem CID | 88921057 |
| Molecular Formula | C23H27F2N5O2 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | 2,5-difluoro-4-[4-[1-(5-methylpyrimidin-2-yl)piperidin-4-yl]oxyiminocyclohexyl]benzamide |
| SMILES | Cc1cnc(N2CCC(ON=C3CCC(c4cc(F)c(C(N)=O)cc4F)CC3)CC2)nc1 |
| InChI | InChI=1S/C23H27F2N5O2/c1-14-12-27-23(28-13-14)30-8-6-17(7-9-30)32-29-16-4-2-15(3-5-16)18-10-21(25)19(22(26)31)11-20(18)24/h10-13,15,17H,2-9H2,1H3,(H2,26,31)/b29-16- |
| InChIKey | UPSKAFIINFBJOX-MWLSYYOVSA-N |
| XLogP | 3.86 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|