C32H44F5N5O — CID 159594595
N-decyl-2,5-difluoro-4-[4-[1-[5-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]oxyiminocyclohexyl]aniline (PubChem CID 159594595) has the molecular formula C32H44F5N5O and a molecular weight of 609.73 g/mol. Its IUPAC name is N-decyl-2,5-difluoro-4-[4-[1-[5-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]oxyiminocyclohexyl]aniline.
| Compound Name | N-decyl-2,5-difluoro-4-[4-[1-[5-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]oxyiminocyclohexyl]aniline |
|---|---|
| PubChem CID | 159594595 |
| Molecular Formula | C32H44F5N5O |
| Molecular Weight | 609.73 g/mol |
| Exact Mass | 609.35 |
| IUPAC Name | N-decyl-2,5-difluoro-4-[4-[1-[5-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]oxyiminocyclohexyl]aniline |
| SMILES | CCCCCCCCCCNc1cc(F)c(C2CCC(=NOC3CCN(c4ncc(C(F)(F)F)cn4)CC3)CC2)cc1F |
| InChI | InChI=1S/C32H44F5N5O/c1-2-3-4-5-6-7-8-9-16-38-30-20-28(33)27(19-29(30)34)23-10-12-25(13-11-23)41-43-26-14-17-42(18-15-26)31-39-21-24(22-40-31)32(35,36)37/h19-23,26,38H,2-18H2,1H3/b41-25- |
| InChIKey | ITUCMGTYCHGRAY-RSEYIHLLSA-N |
| XLogP | 9.03 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.73 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|