C24H25F5N4O2 — CID 88921000
2,5-difluoro-4-[4-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]oxyiminocyclohexyl]benzamide (PubChem CID 88921000) has the molecular formula C24H25F5N4O2 and a molecular weight of 496.48 g/mol. Its IUPAC name is 2,5-difluoro-4-[4-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]oxyiminocyclohexyl]benzamide.
| Compound Name | 2,5-difluoro-4-[4-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]oxyiminocyclohexyl]benzamide |
|---|---|
| PubChem CID | 88921000 |
| Molecular Formula | C24H25F5N4O2 |
| Molecular Weight | 496.48 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | 2,5-difluoro-4-[4-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]oxyiminocyclohexyl]benzamide |
| SMILES | NC(=O)c1cc(F)c(C2CCC(=NOC3CCN(c4ccc(C(F)(F)F)cn4)CC3)CC2)cc1F |
| InChI | InChI=1S/C24H25F5N4O2/c25-20-12-19(23(30)34)21(26)11-18(20)14-1-4-16(5-2-14)32-35-17-7-9-33(10-8-17)22-6-3-15(13-31-22)24(27,28)29/h3,6,11-14,17H,1-2,4-5,7-10H2,(H2,30,34)/b32-16- |
| InChIKey | CPZDVALQHJVVRD-ZMGVVAQMSA-N |
| XLogP | 5.18 |
| TPSA | 80.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.48 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|