C24H34F2N4O4 — CID 88921063
tert-butyl 4-[[[4-[4-(carbamoylamino)-2,5-difluorophenyl]cyclohexylidene]amino]oxymethyl]piperidine-1-carboxylate (PubChem CID 88921063) has the molecular formula C24H34F2N4O4 and a molecular weight of 480.56 g/mol. Its IUPAC name is tert-butyl 4-[[[4-[4-(carbamoylamino)-2,5-difluorophenyl]cyclohexylidene]amino]oxymethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[[4-[4-(carbamoylamino)-2,5-difluorophenyl]cyclohexylidene]amino]oxymethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 88921063 |
| Molecular Formula | C24H34F2N4O4 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | tert-butyl 4-[[[4-[4-(carbamoylamino)-2,5-difluorophenyl]cyclohexylidene]amino]oxymethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CON=C2CCC(c3cc(F)c(NC(N)=O)cc3F)CC2)CC1 |
| InChI | InChI=1S/C24H34F2N4O4/c1-24(2,3)34-23(32)30-10-8-15(9-11-30)14-33-29-17-6-4-16(5-7-17)18-12-20(26)21(13-19(18)25)28-22(27)31/h12-13,15-16H,4-11,14H2,1-3H3,(H3,27,28,31)/b29-17- |
| InChIKey | SUDFZIUALLLSFZ-RHANQZHGSA-N |
| XLogP | 5.13 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|