C23H33F2N3O3 — CID 88920983
tert-butyl 4-[[[4-(4-amino-2,5-difluorophenyl)cyclohexylidene]amino]oxymethyl]piperidine-1-carboxylate (PubChem CID 88920983) has the molecular formula C23H33F2N3O3 and a molecular weight of 437.53 g/mol. Its IUPAC name is tert-butyl 4-[[[4-(4-amino-2,5-difluorophenyl)cyclohexylidene]amino]oxymethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[[4-(4-amino-2,5-difluorophenyl)cyclohexylidene]amino]oxymethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 88920983 |
| Molecular Formula | C23H33F2N3O3 |
| Molecular Weight | 437.53 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | tert-butyl 4-[[[4-(4-amino-2,5-difluorophenyl)cyclohexylidene]amino]oxymethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CON=C2CCC(c3cc(F)c(N)cc3F)CC2)CC1 |
| InChI | InChI=1S/C23H33F2N3O3/c1-23(2,3)31-22(29)28-10-8-15(9-11-28)14-30-27-17-6-4-16(5-7-17)18-12-20(25)21(26)13-19(18)24/h12-13,15-16H,4-11,14,26H2,1-3H3/b27-17- |
| InChIKey | FARKJZOWANIQNP-PKAZHMFMSA-N |
| XLogP | 5.22 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.53 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|