C24H36N8O2 — CID 88921045
1-[4-[4-[1-(5-methylpyrimidin-2-yl)piperidin-4-yl]oxyiminocyclohexyl]-2H-pyrimidin-1-yl]-3-propylurea (PubChem CID 88921045) has the molecular formula C24H36N8O2 and a molecular weight of 468.61 g/mol. Its IUPAC name is 1-[4-[4-[1-(5-methylpyrimidin-2-yl)piperidin-4-yl]oxyiminocyclohexyl]-2H-pyrimidin-1-yl]-3-propylurea.
| Compound Name | 1-[4-[4-[1-(5-methylpyrimidin-2-yl)piperidin-4-yl]oxyiminocyclohexyl]-2H-pyrimidin-1-yl]-3-propylurea |
|---|---|
| PubChem CID | 88921045 |
| Molecular Formula | C24H36N8O2 |
| Molecular Weight | 468.61 g/mol |
| Exact Mass | 468.30 |
| IUPAC Name | 1-[4-[4-[1-(5-methylpyrimidin-2-yl)piperidin-4-yl]oxyiminocyclohexyl]-2H-pyrimidin-1-yl]-3-propylurea |
| SMILES | CCCNC(=O)NN1C=CC(C2CCC(=NOC3CCN(c4ncc(C)cn4)CC3)CC2)=NC1 |
| InChI | InChI=1S/C24H36N8O2/c1-3-11-25-24(33)29-32-14-10-22(28-17-32)19-4-6-20(7-5-19)30-34-21-8-12-31(13-9-21)23-26-15-18(2)16-27-23/h10,14-16,19,21H,3-9,11-13,17H2,1-2H3,(H2,25,29,33)/b30-20- |
| InChIKey | PINMSHODRQJUSF-COEJQBHMSA-N |
| XLogP | 3.17 |
| TPSA | 107.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.61 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|