C16H20N4O4 — CID 145257030
8,16-bis(prop-2-enyl)-5,14-dioxa-4,8,13,16-tetrazadispiro[5.2.59.26]hexadeca-3,12-diene-7,15-dione (PubChem CID 145257030) has the molecular formula C16H20N4O4 and a molecular weight of 332.36 g/mol. Its IUPAC name is 8,16-bis(prop-2-enyl)-5,14-dioxa-4,8,13,16-tetrazadispiro[5.2.59.26]hexadeca-3,12-diene-7,15-dione.
| Compound Name | 8,16-bis(prop-2-enyl)-5,14-dioxa-4,8,13,16-tetrazadispiro[5.2.59.26]hexadeca-3,12-diene-7,15-dione |
|---|---|
| PubChem CID | 145257030 |
| Molecular Formula | C16H20N4O4 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 8,16-bis(prop-2-enyl)-5,14-dioxa-4,8,13,16-tetrazadispiro[5.2.59.26]hexadeca-3,12-diene-7,15-dione |
| SMILES | C=CCN1C(=O)C2(CCC=NO2)N(CC=C)C(=O)C12CCC=NO2 |
| InChI | InChI=1S/C16H20N4O4/c1-3-11-19-13(21)16(8-6-10-18-24-16)20(12-4-2)14(22)15(19)7-5-9-17-23-15/h3-4,9-10H,1-2,5-8,11-12H2 |
| InChIKey | VWVIUTDOWHFMOR-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 83.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|