C12H16N4O4 — CID 145257006
8,16-dimethyl-5,14-dioxa-4,8,13,16-tetrazadispiro[5.2.59.26]hexadeca-3,12-diene-7,15-dione (PubChem CID 145257006) has the molecular formula C12H16N4O4 and a molecular weight of 280.28 g/mol. Its IUPAC name is 8,16-dimethyl-5,14-dioxa-4,8,13,16-tetrazadispiro[5.2.59.26]hexadeca-3,12-diene-7,15-dione.
| Compound Name | 8,16-dimethyl-5,14-dioxa-4,8,13,16-tetrazadispiro[5.2.59.26]hexadeca-3,12-diene-7,15-dione |
|---|---|
| PubChem CID | 145257006 |
| Molecular Formula | C12H16N4O4 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 8,16-dimethyl-5,14-dioxa-4,8,13,16-tetrazadispiro[5.2.59.26]hexadeca-3,12-diene-7,15-dione |
| SMILES | CN1C(=O)C2(CCC=NO2)N(C)C(=O)C12CCC=NO2 |
| InChI | InChI=1S/C12H16N4O4/c1-15-9(17)12(6-4-8-14-20-12)16(2)10(18)11(15)5-3-7-13-19-11/h7-8H,3-6H2,1-2H3 |
| InChIKey | IEQRWSYBDIXDJC-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 83.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |