C16H24N4O6 — CID 145257031
8,16-bis(3-hydroxypropyl)-5,14-dioxa-4,8,13,16-tetrazadispiro[5.2.59.26]hexadeca-3,12-diene-7,15-dione (PubChem CID 145257031) has the molecular formula C16H24N4O6 and a molecular weight of 368.39 g/mol. Its IUPAC name is 8,16-bis(3-hydroxypropyl)-5,14-dioxa-4,8,13,16-tetrazadispiro[5.2.59.26]hexadeca-3,12-diene-7,15-dione.
| Compound Name | 8,16-bis(3-hydroxypropyl)-5,14-dioxa-4,8,13,16-tetrazadispiro[5.2.59.26]hexadeca-3,12-diene-7,15-dione |
|---|---|
| PubChem CID | 145257031 |
| Molecular Formula | C16H24N4O6 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 8,16-bis(3-hydroxypropyl)-5,14-dioxa-4,8,13,16-tetrazadispiro[5.2.59.26]hexadeca-3,12-diene-7,15-dione |
| SMILES | O=C1N(CCCO)C2(CCC=NO2)C(=O)N(CCCO)C12CCC=NO2 |
| InChI | InChI=1S/C16H24N4O6/c21-11-3-9-19-14(24)16(6-2-8-18-26-16)20(10-4-12-22)13(23)15(19)5-1-7-17-25-15/h7-8,21-22H,1-6,9-12H2 |
| InChIKey | AAILZCAIKVFGJQ-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 124.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |