C16H20N4O8 — CID 145257029
3-[8-(2-carboxyethyl)-7,15-dioxo-5,14-dioxa-4,8,13,16-tetrazadispiro[5.2.59.26]hexadeca-3,12-dien-16-yl]propanoic acid (PubChem CID 145257029) has the molecular formula C16H20N4O8 and a molecular weight of 396.36 g/mol. Its IUPAC name is 3-[8-(2-carboxyethyl)-7,15-dioxo-5,14-dioxa-4,8,13,16-tetrazadispiro[5.2.59.26]hexadeca-3,12-dien-16-yl]propanoic acid.
| Compound Name | 3-[8-(2-carboxyethyl)-7,15-dioxo-5,14-dioxa-4,8,13,16-tetrazadispiro[5.2.59.26]hexadeca-3,12-dien-16-yl]propanoic acid |
|---|---|
| PubChem CID | 145257029 |
| Molecular Formula | C16H20N4O8 |
| Molecular Weight | 396.36 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 3-[8-(2-carboxyethyl)-7,15-dioxo-5,14-dioxa-4,8,13,16-tetrazadispiro[5.2.59.26]hexadeca-3,12-dien-16-yl]propanoic acid |
| SMILES | O=C(O)CCN1C(=O)C2(CCC=NO2)N(CCC(=O)O)C(=O)C12CCC=NO2 |
| InChI | InChI=1S/C16H20N4O8/c21-11(22)3-9-19-14(26)16(6-2-8-18-28-16)20(10-4-12(23)24)13(25)15(19)5-1-7-17-27-15/h7-8H,1-6,9-10H2,(H,21,22)(H,23,24) |
| InChIKey | BPKDBSWVZYBKGK-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 158.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.36 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |