C16H22N4O7 — CID 145257035
3-[8-(3-hydroxypropyl)-7,15-dioxo-5,14-dioxa-4,8,13,16-tetrazadispiro[5.2.59.26]hexadeca-3,12-dien-16-yl]propanoic acid (PubChem CID 145257035) has the molecular formula C16H22N4O7 and a molecular weight of 382.37 g/mol. Its IUPAC name is 3-[8-(3-hydroxypropyl)-7,15-dioxo-5,14-dioxa-4,8,13,16-tetrazadispiro[5.2.59.26]hexadeca-3,12-dien-16-yl]propanoic acid.
| Compound Name | 3-[8-(3-hydroxypropyl)-7,15-dioxo-5,14-dioxa-4,8,13,16-tetrazadispiro[5.2.59.26]hexadeca-3,12-dien-16-yl]propanoic acid |
|---|---|
| PubChem CID | 145257035 |
| Molecular Formula | C16H22N4O7 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 3-[8-(3-hydroxypropyl)-7,15-dioxo-5,14-dioxa-4,8,13,16-tetrazadispiro[5.2.59.26]hexadeca-3,12-dien-16-yl]propanoic acid |
| SMILES | O=C(O)CCN1C(=O)C2(CCC=NO2)N(CCCO)C(=O)C12CCC=NO2 |
| InChI | InChI=1S/C16H22N4O7/c21-11-3-9-19-13(24)16(6-2-8-18-27-16)20(10-4-12(22)23)14(25)15(19)5-1-7-17-26-15/h7-8,21H,1-6,9-11H2,(H,22,23) |
| InChIKey | FUNBTPYKNPNMHP-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 141.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |