C12H18N4O4 — CID 145256988
5,14-dioxa-4,8,13,16-tetrazadispiro[5.2.59.26]hexadeca-3,12-diene-7,15-dione;ethane (PubChem CID 145256988) has the molecular formula C12H18N4O4 and a molecular weight of 282.30 g/mol. Its IUPAC name is 5,14-dioxa-4,8,13,16-tetrazadispiro[5.2.59.26]hexadeca-3,12-diene-7,15-dione;ethane.
| Compound Name | 5,14-dioxa-4,8,13,16-tetrazadispiro[5.2.59.26]hexadeca-3,12-diene-7,15-dione;ethane |
|---|---|
| PubChem CID | 145256988 |
| Molecular Formula | C12H18N4O4 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 5,14-dioxa-4,8,13,16-tetrazadispiro[5.2.59.26]hexadeca-3,12-diene-7,15-dione;ethane |
| SMILES | CC.O=C1NC2(CCC=NO2)C(=O)NC12CCC=NO2 |
| InChI | InChI=1S/C10H12N4O4.C2H6/c15-7-9(3-1-5-11-17-9)13-8(16)10(14-7)4-2-6-12-18-10;1-2/h5-6H,1-4H2,(H,13,16)(H,14,15);1-2H3 |
| InChIKey | GORHMPZZSWQJTF-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |