C11H14N4O4 — CID 145257016
16-methyl-5,14-dioxa-4,8,13,16-tetrazadispiro[5.2.59.26]hexadeca-3,12-diene-7,15-dione (PubChem CID 145257016) has the molecular formula C11H14N4O4 and a molecular weight of 266.26 g/mol. Its IUPAC name is 16-methyl-5,14-dioxa-4,8,13,16-tetrazadispiro[5.2.59.26]hexadeca-3,12-diene-7,15-dione.
| Compound Name | 16-methyl-5,14-dioxa-4,8,13,16-tetrazadispiro[5.2.59.26]hexadeca-3,12-diene-7,15-dione |
|---|---|
| PubChem CID | 145257016 |
| Molecular Formula | C11H14N4O4 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 16-methyl-5,14-dioxa-4,8,13,16-tetrazadispiro[5.2.59.26]hexadeca-3,12-diene-7,15-dione |
| SMILES | CN1C(=O)C2(CCC=NO2)NC(=O)C12CCC=NO2 |
| InChI | InChI=1S/C11H14N4O4/c1-15-9(17)10(4-2-6-12-18-10)14-8(16)11(15)5-3-7-13-19-11/h6-7H,2-5H2,1H3,(H,14,16) |
| InChIKey | APTFVESNVAXQQX-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |