C10H12N4O4 — CID 145257044
(6R,9R)-5,14-dioxa-4,8,13,16-tetrazadispiro[5.2.59.26]hexadeca-3,12-diene-7,15-dione (PubChem CID 145257044) has the molecular formula C10H12N4O4 and a molecular weight of 252.23 g/mol. Its IUPAC name is (6R,9R)-5,14-dioxa-4,8,13,16-tetrazadispiro[5.2.59.26]hexadeca-3,12-diene-7,15-dione.
| Compound Name | (6R,9R)-5,14-dioxa-4,8,13,16-tetrazadispiro[5.2.59.26]hexadeca-3,12-diene-7,15-dione |
|---|---|
| PubChem CID | 145257044 |
| Molecular Formula | C10H12N4O4 |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | (6R,9R)-5,14-dioxa-4,8,13,16-tetrazadispiro[5.2.59.26]hexadeca-3,12-diene-7,15-dione |
| SMILES | O=C1N[C@@]2(CCC=NO2)C(=O)N[C@@]12CCC=NO2 |
| InChI | InChI=1S/C10H12N4O4/c15-7-9(3-1-5-11-17-9)13-8(16)10(14-7)4-2-6-12-18-10/h5-6H,1-4H2,(H,13,16)(H,14,15)/t9-,10-/m1/s1 |
| InChIKey | JQMQTWKKWQBHPM-NXEZZACHSA-N |
| XLogP | -0.78 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |