C8H8N4O4 — CID 145257009
(5R,8R)-4,12-dioxa-3,7,11,14-tetrazadispiro[4.2.48.25]tetradeca-2,10-diene-6,13-dione (PubChem CID 145257009) has the molecular formula C8H8N4O4 and a molecular weight of 224.18 g/mol. Its IUPAC name is (5R,8R)-4,12-dioxa-3,7,11,14-tetrazadispiro[4.2.48.25]tetradeca-2,10-diene-6,13-dione.
| Compound Name | (5R,8R)-4,12-dioxa-3,7,11,14-tetrazadispiro[4.2.48.25]tetradeca-2,10-diene-6,13-dione |
|---|---|
| PubChem CID | 145257009 |
| Molecular Formula | C8H8N4O4 |
| Molecular Weight | 224.18 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | (5R,8R)-4,12-dioxa-3,7,11,14-tetrazadispiro[4.2.48.25]tetradeca-2,10-diene-6,13-dione |
| SMILES | O=C1N[C@@]2(CC=NO2)C(=O)N[C@@]12CC=NO2 |
| InChI | InChI=1S/C8H8N4O4/c13-5-7(1-3-9-15-7)11-6(14)8(12-5)2-4-10-16-8/h3-4H,1-2H2,(H,11,14)(H,12,13)/t7-,8-/m1/s1 |
| InChIKey | SFGFAWODSZZQDO-HTQZYQBOSA-N |
| XLogP | -1.56 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.18 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |