C15H20N6O2 — CID 145257167
N-ethyl-4-(2-methoxyethoxy)-5-(1-methylpyrazol-4-yl)pyrrolo[3,2-d]pyrimidin-2-amine (PubChem CID 145257167) has the molecular formula C15H20N6O2 and a molecular weight of 316.37 g/mol. Its IUPAC name is N-ethyl-4-(2-methoxyethoxy)-5-(1-methylpyrazol-4-yl)pyrrolo[3,2-d]pyrimidin-2-amine.
| Compound Name | N-ethyl-4-(2-methoxyethoxy)-5-(1-methylpyrazol-4-yl)pyrrolo[3,2-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 145257167 |
| Molecular Formula | C15H20N6O2 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | N-ethyl-4-(2-methoxyethoxy)-5-(1-methylpyrazol-4-yl)pyrrolo[3,2-d]pyrimidin-2-amine |
| SMILES | CCNc1nc(OCCOC)c2c(ccn2-c2cnn(C)c2)n1 |
| InChI | InChI=1S/C15H20N6O2/c1-4-16-15-18-12-5-6-21(11-9-17-20(2)10-11)13(12)14(19-15)23-8-7-22-3/h5-6,9-10H,4,7-8H2,1-3H3,(H,16,18,19) |
| InChIKey | SDNFGJLFELODRT-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 79.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|