C26H26N4O2 — CID 145259803
2-[[2-[[(R)-(2-hydroxyphenyl)-pyridin-2-ylmethyl]amino]ethylamino]-pyridin-2-ylmethyl]phenol (PubChem CID 145259803) has the molecular formula C26H26N4O2 and a molecular weight of 426.52 g/mol. Its IUPAC name is 2-[[2-[[(R)-(2-hydroxyphenyl)-pyridin-2-ylmethyl]amino]ethylamino]-pyridin-2-ylmethyl]phenol.
| Compound Name | 2-[[2-[[(R)-(2-hydroxyphenyl)-pyridin-2-ylmethyl]amino]ethylamino]-pyridin-2-ylmethyl]phenol |
|---|---|
| PubChem CID | 145259803 |
| Molecular Formula | C26H26N4O2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 2-[[2-[[(R)-(2-hydroxyphenyl)-pyridin-2-ylmethyl]amino]ethylamino]-pyridin-2-ylmethyl]phenol |
| SMILES | Oc1ccccc1C(NCCN[C@@H](c1ccccn1)c1ccccc1O)c1ccccn1 |
| InChI | InChI=1S/C26H26N4O2/c31-23-13-3-1-9-19(23)25(21-11-5-7-15-27-21)29-17-18-30-26(22-12-6-8-16-28-22)20-10-2-4-14-24(20)32/h1-16,25-26,29-32H,17-18H2/t25-,26?/m1/s1 |
| InChIKey | ANZTXMKFVRYSAN-DCWQJPKNSA-N |
| XLogP | 3.95 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|