C15H19N3 — CID 60889324
N'-[phenyl(pyridin-2-yl)methyl]propane-1,3-diamine (PubChem CID 60889324) has the molecular formula C15H19N3 and a molecular weight of 241.34 g/mol. Its IUPAC name is N'-[phenyl(pyridin-2-yl)methyl]propane-1,3-diamine.
| Compound Name | N'-[phenyl(pyridin-2-yl)methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 60889324 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | N'-[phenyl(pyridin-2-yl)methyl]propane-1,3-diamine |
| SMILES | NCCCNC(c1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C15H19N3/c16-10-6-12-18-15(13-7-2-1-3-8-13)14-9-4-5-11-17-14/h1-5,7-9,11,15,18H,6,10,12,16H2 |
| InChIKey | ZKLNYNFLOKDNJJ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|