C16H17F3N2 — CID 115516236
4,4,4-trifluoro-N-[phenyl(pyridin-2-yl)methyl]butan-1-amine (PubChem CID 115516236) has the molecular formula C16H17F3N2 and a molecular weight of 294.32 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-[phenyl(pyridin-2-yl)methyl]butan-1-amine.
| Compound Name | 4,4,4-trifluoro-N-[phenyl(pyridin-2-yl)methyl]butan-1-amine |
|---|---|
| PubChem CID | 115516236 |
| Molecular Formula | C16H17F3N2 |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 4,4,4-trifluoro-N-[phenyl(pyridin-2-yl)methyl]butan-1-amine |
| SMILES | FC(F)(F)CCCNC(c1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C16H17F3N2/c17-16(18,19)10-6-12-21-15(13-7-2-1-3-8-13)14-9-4-5-11-20-14/h1-5,7-9,11,15,21H,6,10,12H2 |
| InChIKey | VQDVDCQWKNNEJC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|