C18H24N2S — CID 104926413
5-methylsulfanyl-N-[phenyl(pyridin-2-yl)methyl]pentan-1-amine (PubChem CID 104926413) has the molecular formula C18H24N2S and a molecular weight of 300.47 g/mol. Its IUPAC name is 5-methylsulfanyl-N-[phenyl(pyridin-2-yl)methyl]pentan-1-amine.
| Compound Name | 5-methylsulfanyl-N-[phenyl(pyridin-2-yl)methyl]pentan-1-amine |
|---|---|
| PubChem CID | 104926413 |
| Molecular Formula | C18H24N2S |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 5-methylsulfanyl-N-[phenyl(pyridin-2-yl)methyl]pentan-1-amine |
| SMILES | CSCCCCCNC(c1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C18H24N2S/c1-21-15-9-3-7-14-20-18(16-10-4-2-5-11-16)17-12-6-8-13-19-17/h2,4-6,8,10-13,18,20H,3,7,9,14-15H2,1H3 |
| InChIKey | KKRYCLDBVSORFO-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|