C21H27N5O4 — CID 145261252
2-(2,6-dimethylmorpholin-4-yl)-N-(6-methoxypyridazin-3-yl)-5,6,8,9-tetrahydrooxepino[4,5-b]pyridine-4-carboxamide (PubChem CID 145261252) has the molecular formula C21H27N5O4 and a molecular weight of 413.48 g/mol. Its IUPAC name is 2-(2,6-dimethylmorpholin-4-yl)-N-(6-methoxypyridazin-3-yl)-5,6,8,9-tetrahydrooxepino[4,5-b]pyridine-4-carboxamide.
| Compound Name | 2-(2,6-dimethylmorpholin-4-yl)-N-(6-methoxypyridazin-3-yl)-5,6,8,9-tetrahydrooxepino[4,5-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 145261252 |
| Molecular Formula | C21H27N5O4 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | 2-(2,6-dimethylmorpholin-4-yl)-N-(6-methoxypyridazin-3-yl)-5,6,8,9-tetrahydrooxepino[4,5-b]pyridine-4-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cc(N3CC(C)OC(C)C3)nc3c2CCOCC3)nn1 |
| InChI | InChI=1S/C21H27N5O4/c1-13-11-26(12-14(2)30-13)19-10-16(15-6-8-29-9-7-17(15)22-19)21(27)23-18-4-5-20(28-3)25-24-18/h4-5,10,13-14H,6-9,11-12H2,1-3H3,(H,23,24,27) |
| InChIKey | XIKDDIPDCAXXQW-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |